CymitQuimica logo

CAS 953-69-5

:

Bicyclo[2.2.2]octane-1-carboxylic acid, 4-phenyl-

Description:
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-phenyl- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a bicyclo[2.2.2]octane framework with a carboxylic acid functional group and a phenyl substituent. This compound typically exhibits properties associated with both bicyclic systems and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The bicyclic structure contributes to its rigidity and may influence its chemical reactivity and interactions with other molecules. The phenyl group can enhance the compound's hydrophobic characteristics and may also participate in π-π stacking interactions. Bicyclo[2.2.2]octane derivatives are of interest in various fields, including medicinal chemistry and materials science, due to their unique structural properties and potential applications in drug design and synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C15H18O2
InChI:InChI=1S/C15H18O2/c16-13(17)15-9-6-14(7-10-15,8-11-15)12-4-2-1-3-5-12/h1-5H,6-11H2,(H,16,17)
InChI key:SQHNZAVLCQLHKE-UHFFFAOYSA-N
SMILES:C1CC2(CCC1(CC2)C3=CC=CC=C3)C(=O)O
Found 4 products.