CymitQuimica logo

CAS 953045-91-5

:

7-chloro-3-methylthieno[3,2-b]pyridine

Description:
7-Chloro-3-methylthieno[3,2-b]pyridine is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a thieno and a pyridine ring. The presence of a chlorine atom at the 7-position and a methyl group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the thieno and pyridine moieties, which are often associated with various biological activities. Additionally, the chlorine substituent can influence the compound's electronic properties and interactions with biological targets. As with many heterocycles, the compound may also exhibit interesting photophysical properties, making it a candidate for further research in fields such as materials science and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C8H6ClNS
InChI:InChI=1S/C8H6ClNS/c1-5-4-11-8-6(9)2-3-10-7(5)8/h2-4H,1H3
InChI key:MXODMYMGCQSCRT-UHFFFAOYSA-N
SMILES:CC1=CSC2=C(C=CN=C12)Cl
Found 4 products.