CymitQuimica logo

CAS 953071-73-3

:

tert-butyl 4-(1H-benzo[d]iMidazol-2-yl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(1H-benzo[d]imidazol-2-yl)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a benzo[d]imidazole moiety, and a tert-butyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents, reflecting its hydrophobic tert-butyl group, while the presence of polar functional groups may enhance solubility in certain polar solvents. It is likely to display biological activity due to the presence of the benzo[d]imidazole, which is known for its pharmacological properties. The compound may also participate in various chemical reactions, including ester hydrolysis and nucleophilic substitutions, due to the reactivity of the carboxylate group. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as the compound may exhibit toxicity or other hazardous properties.
Formula:C17H23N3O2
InChI:InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)20-10-8-12(9-11-20)15-18-13-6-4-5-7-14(13)19-15/h4-7,12H,8-11H2,1-3H3,(H,18,19)
InChI key:KDZVWRLDUPCQJD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C2=NC3=CC=CC=C3N2
Found 5 products.