CAS 953079-94-2
:pyrrolidine-3-carboxylic acid hydrochloride
Description:
Pyrrolidine-3-carboxylic acid hydrochloride, identified by its CAS number 953079-94-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group at the 3-position of the pyrrolidine ring, contributing to its acidic properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. Pyrrolidine-3-carboxylic acid hydrochloride is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug development and as a building block in organic synthesis. Its structural features may influence its biological activity, making it a subject of research for therapeutic uses. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H10ClNO2
InChI:InChI=1/C5H9NO2.ClH/c7-5(8)4-1-2-6-3-4;/h4,6H,1-3H2,(H,7,8);1H
SMILES:C1CNCC1C(=O)O.Cl
Synonyms:- 3-Pyrrolidinecarboxylic acid, hydrochloride (1:1)
- Pyrrolidine-3-carboxylic acid hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
DL-β-Proline hydrochloride, 95%
CAS:It is an important organic intermediate used in agrochemicals, pharmaceuticals and dyestuff fields. It is used as a key intermediate to prepare two different pyrrolidines. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation andFormula:C5H9NO2•HClPurity:95%Molecular weight:151.59Pyrrolidine-3-carboxylic acid hydrochloride
CAS:Pyrrolidine-3-carboxylic acid hydrochlorideFormula:C5H9NO2·ClHPurity:97%Molecular weight:151.59139Pyrrolidine-3-carboxylic acid, HCl
CAS:Formula:C5H10ClNO2Purity:95%Color and Shape:SolidMolecular weight:151.5914H-β-Pro-OH·HCl
CAS:Pyrrolidine-3-carboxylic acid hydrochlorideFormula:C5H10ClNO2Purity:95%Molecular weight:151.59




