CAS 95311-95-8

Lucidenic acid B

Description:

Lucidenic acid B is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Lucidenic acid B exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of signaling pathways and inhibition of specific enzymes. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, particularly in the field of natural products. Additionally, lucidenic acid B is often evaluated for its safety and efficacy in various biological systems, contributing to the understanding of its potential health benefits. As with many natural compounds, further research is necessary to fully elucidate its pharmacokinetics, bioavailability, and therapeutic potential.

Formula: C₂₇H₃₈O₇

InChI: InChI=1S/C27H38O7/c1-13(7-8-19(31)32)14-11-18(30)27(6)20-15(28)12-16-24(2,3)17(29)9-10-25(16,4)21(20)22(33)23(34)26(14,27)5/h13-16,23,28,34H,7-12H2,1-6H3,(H,31,32)/t13-,14-,15+,16+,23-,25+,26+,27+/m1/s1

InChI key: InChIKey=GYRDSOABOBCYST-HFAARYGVSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)C(=O)CC4)[H])C(=O)[C@@H](O)[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]

Synonyms:

• (+)-Lucidenic acid B
• (5α,7β,12β)-7,12-Dihydroxy-4,4,14-trimethyl-3,11,15-trioxochol-8-en-24-oic acid
• Lucidenic acid B
• Chol-8-en-24-oic acid, 7,12-dihydroxy-4,4,14-trimethyl-3,11,15-trioxo-, (5α,7β,12β)-

Lucidenic acid B

CAS: 95311-95-8

Lucidenic acid B

Purity: ≥98%

Molecular weight: 474.59g/mol

Ref: 54-BUP21799

Lucidenic acid B

CAS: 95311-95-8

Formula: C₂₇H₃₈O₇

Molecular weight: 474.59

Ref: 7W-GY1459

Lucidenic acid B

CAS: 95311-95-8

Lucidenic acid B from Ganoderma lucidum triggers apoptosis in leukemia cells and inhibits liver cancer cell invasion by blocking MAPK/ERK signaling.

Formula: C₂₇H₃₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 474.59

Ref: TM-TN1880

Lucidenic acid B

CAS: 95311-95-8

Formula: C₂₇H₃₈O₇

Purity: 95%~99%

Molecular weight: 474.594

Ref: BP-BP3239

Lucidenic Acid B

Controlled Product

CAS: 95311-95-8

Formula: C₂₇H₃₈O₇

Color and Shape: Off-White

Molecular weight: 474.59

Ref: TR-L473720

Lucidenic acid B

Controlled Product

CAS: 95311-95-8

Lucidenic acid B is a molecule that has been shown to have cytotoxic effects on human HL-60 cells. It also has the ability to reduce the glomerular filtration rate, which may be due to its ability to inhibit the synthesis of growth factors and mitochondrial membrane potential. Lucidenic acid B also inhibits cancer cell proliferation, as it induces apoptosis. In addition, this molecule has been shown to inhibit cyclooxygenase-2 (COX-2) activity, which leads to an inhibition of prostaglandin synthesis and subsequent prostaglandin-mediated inflammation. Lucidenic acid B also specifically binds to NF-κB DNA binding sites and inhibits nuclear translocation of NF-κB subunits p65 and p50.

Formula: C₂₇H₃₈O₇

Purity: Min. 95%

Molecular weight: 474.59 g/mol

Ref: 3D-VDA31195