CAS 95311-95-8
:Lucidenic acid B
Description:
Lucidenic acid B is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Lucidenic acid B exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of signaling pathways and inhibition of specific enzymes. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, particularly in the field of natural products. Additionally, lucidenic acid B is often evaluated for its safety and efficacy in various biological systems, contributing to the understanding of its potential health benefits. As with many natural compounds, further research is necessary to fully elucidate its pharmacokinetics, bioavailability, and therapeutic potential.
Formula:C27H38O7
InChI:InChI=1S/C27H38O7/c1-13(7-8-19(31)32)14-11-18(30)27(6)20-15(28)12-16-24(2,3)17(29)9-10-25(16,4)21(20)22(33)23(34)26(14,27)5/h13-16,23,28,34H,7-12H2,1-6H3,(H,31,32)/t13-,14-,15+,16+,23-,25+,26+,27+/m1/s1
InChI key:InChIKey=GYRDSOABOBCYST-HFAARYGVSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)C(=O)CC4)[H])C(=O)[C@@H](O)[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]
Synonyms:- (+)-Lucidenic acid B
- (5α,7β,12β)-7,12-Dihydroxy-4,4,14-trimethyl-3,11,15-trioxochol-8-en-24-oic acid
- Lucidenic acid B
- Chol-8-en-24-oic acid, 7,12-dihydroxy-4,4,14-trimethyl-3,11,15-trioxo-, (5α,7β,12β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Lucidenic acid B
CAS:Lucidenic acid B from Ganoderma lucidum triggers apoptosis in leukemia cells and inhibits liver cancer cell invasion by blocking MAPK/ERK signaling.Formula:C27H38O7Purity:98%Color and Shape:SolidMolecular weight:474.59Lucidenic acid B
CAS:Controlled ProductLucidenic acid B is a molecule that has been shown to have cytotoxic effects on human HL-60 cells. It also has the ability to reduce the glomerular filtration rate, which may be due to its ability to inhibit the synthesis of growth factors and mitochondrial membrane potential. Lucidenic acid B also inhibits cancer cell proliferation, as it induces apoptosis. In addition, this molecule has been shown to inhibit cyclooxygenase-2 (COX-2) activity, which leads to an inhibition of prostaglandin synthesis and subsequent prostaglandin-mediated inflammation. Lucidenic acid B also specifically binds to NF-κB DNA binding sites and inhibits nuclear translocation of NF-κB subunits p65 and p50.
Formula:C27H38O7Purity:Min. 95%Molecular weight:474.59 g/mol






