CymitQuimica logo

CAS 95311-97-0

:

Ganoderic acid C

Description:
Ganoderic acid C is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups, contributing to its bioactivity. Ganoderic acid C exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in both traditional medicine and modern pharmacology. Its solubility is generally low in water but can be dissolved in organic solvents, which is typical for many triterpenoids. The compound's mechanism of action is believed to involve modulation of various signaling pathways, enhancing immune response and exhibiting cytotoxic effects on certain cancer cell lines. Additionally, Ganoderic acid C is studied for its potential in promoting cardiovascular health and improving liver function. Overall, its diverse biological activities and therapeutic potential make it a significant subject of research in natural product chemistry and medicinal applications.
Formula:C30H42O7
InChI:InChI=1/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21,32H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,28+,29-,30+/m1/s1
InChI key:InChIKey=YTVGSCZIHGRVAV-NJNFCIENSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)C(=O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC(C[C@H](C(O)=O)C)=O)C)(CC2=O)[H]
Synonyms:
  • Lanost-8-en-26-oic acid, 7-hydroxy-3,11,15,23-tetraoxo-, (7β,25R)-
  • (7β,25R)-7-Hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
  • Ganoderic acid C
  • Ganoderic acid C 1
  • See more synonyms
Found 5 products.