CymitQuimica logo

CAS 95333-14-5

:

7-Benzofurancarboxaldehyde

Description:
7-Benzofurancarboxaldehyde, with the CAS number 95333-14-5, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring, along with an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its aromatic properties and can exhibit a distinctive odor. The presence of the aldehyde group makes it reactive, particularly in nucleophilic addition reactions, and it can participate in various chemical transformations, including oxidation and condensation reactions. 7-Benzofurancarboxaldehyde is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H6O2
InChI:InChI=1S/C9H6O2/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-6H
InChI key:InChIKey=RGPUSZZTRKTMNA-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(C=CO2)=CC=C1
Synonyms:
  • 7-Benzofurancarboxaldehyde
  • 7-Formylbenzofuran
  • 1-Benzofuran-7-carbaldehyde
Found 5 products.