CAS 95383-17-8
:5-bromo-4-chloro-2-methoxybenzoic acid
Description:
5-Bromo-4-chloro-2-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a bromine atom at the 5-position, a chlorine atom at the 4-position, and a methoxy group at the 2-position. This compound typically appears as a solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring and the substituents. The presence of halogen atoms (bromine and chlorine) can impart unique reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The methoxy group can also influence the compound's electronic properties and reactivity. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse functional groups and potential applications.
Formula:C8H6BrClO3
InChI:InChI=1/C8H6BrClO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,1H3,(H,11,12)
SMILES:COc1cc(c(cc1C(=O)O)Br)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-4-chloro-2-methoxybenzoic acid
CAS:5-Bromo-4-chloro-2-methoxybenzoic acidFormula:C8H6BrClO3Purity:≥95%Color and Shape:SolidMolecular weight:265.488445-Bromo-4-chloro-2-methoxybenzoic acid
CAS:Formula:C8H6BrClO3Purity:95.0%Color and Shape:SolidMolecular weight:265.495-bromo-4-chloro-2-methoxybenzoic acid
CAS:Sodium fluoride is a salt of sodium and fluoride ions, with the chemical formula NaF. It is an ionic compound, which is a crystalline solid that dissolves in water to give off the strong odor of hydrofluoric acid. This compound has been used for many years as an expectorant in cough medicines. Sodium fluoride is also used as a preservative in mouthwashes and toothpastes. It may be found in combination with other substances such as potassium iodide, sodium laureth sulfate, or sodium lauryl sulfate.Formula:C8H6BrClO3Purity:Min. 95%Molecular weight:265.5 g/mol




