CAS 95399-93-2

Formula: C5H7FO3

InChI: InChI=1S/C5H7FO3/c1-9-5(8)2-4(7)3-6/h2-3H2,1H3

InChI key: OJYJRDRXGWCIND-UHFFFAOYSA-N

SMILES: COC(=O)CC(=O)CF

Methyl 4-fluoro-3-oxobutanoate

CAS: 95399-93-2

Methyl 4-fluoro-3-oxobutanoate

Formula: C₅H₇FO₃

Purity: 95%

Molecular weight: 134.11

Ref: 54-PC1027998

Methyl 4-fluoro-3-oxobutanoate

CAS: 95399-93-2

Purity: 95%

Ref: IN-DA01XI8A

Methyl 4-fluoro-3-oxobutanoate

CAS: 95399-93-2

Methyl 4-fluoro-3-oxobutanoate is a reagent in organic chemistry that undergoes scission reactions. It is a colorless liquid with a pungent, irritating odor and a boiling point of 225°C. Methyl 4-fluoro-3-oxobutanoate can be used for the synthesis of various aromatic compounds. The mechanism of this reaction involves nucleophilic attack by pyridine or other basic solvents on the electrophilic carbon atom. This leads to the formation of an intermediate carbocation which then undergoes intramolecular fragmentation to yield the desired product.

Formula: C₅H₇FO₃

Purity: Min. 95%

Molecular weight: 134.11 g/mol

Ref: 3D-VDA39993