CymitQuimica logo

CAS 954-18-7

:

1H-Pyrrole-2,3,4,5-tetracarboxylic acid

Description:
1H-Pyrrole-2,3,4,5-tetracarboxylic acid, also known as pyrrole-2,3,4,5-tetracarboxylic acid, is an organic compound characterized by its pyrrole ring structure with four carboxylic acid functional groups attached at positions 2, 3, 4, and 5. This compound is typically a white to off-white solid and is soluble in water due to the presence of multiple carboxylic acid groups, which can ionize and interact with water molecules. It exhibits acidic properties, with the ability to donate protons, making it useful in various chemical reactions and applications. The presence of the pyrrole ring contributes to its potential biological activity, as pyrrole derivatives are often found in natural products and pharmaceuticals. Additionally, this compound can participate in coordination chemistry, forming complexes with metal ions, which may have implications in catalysis and materials science. Its unique structure and properties make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C8H5NO8
InChI:InChI=1S/C8H5NO8/c10-5(11)1-2(6(12)13)4(8(16)17)9-3(1)7(14)15/h9H,(H,10,11)(H,12,13)(H,14,15)(H,16,17)
InChI key:InChIKey=VRAMBVNDRDGAQP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C(O)=O)=C(C(O)=O)NC1C(O)=O
Synonyms:
  • Pyrrole-2,3,4,5-tetracarboxylic acid
  • 1H-Pyrrole-2,3,4,5-tetracarboxylic acid
Found 2 products.