CAS 954225-36-6
:1-(Cyclopropylmethyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid
Description:
1-(Cyclopropylmethyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid, with the CAS number 954225-36-6, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a cyclopropylmethyl group, which contributes to its unique structural properties and potential biological activity. The dihydro-2-oxo moiety indicates that it contains a carbonyl group (C=O) adjacent to a saturated carbon framework, which can influence its reactivity and interactions with biological targets. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in the molecular structure.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c12-9-8(10(13)14)2-1-5-11(9)6-7-3-4-7/h1-2,5,7H,3-4,6H2,(H,13,14)
InChI key:InChIKey=YLEMKSGXWUJNDU-UHFFFAOYSA-N
SMILES:C(N1C(=O)C(C(O)=O)=CC=C1)C2CC2
Synonyms:- 1-(Cyclopropylmethyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 1-(cyclopropylmethyl)-1,2-dihydro-2-oxo-
- 1-(cyclopropylmethyl)-2-oxopyridine-3-carboxylic acid
- 1-(cyclopropylmethyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(Cyclopropylmethyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid
CAS:Formula:C10H11NO3Molecular weight:193.202
