CymitQuimica logo

CAS 954236-44-3

:

tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Description:
Tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a five-membered ring fused to a seven-membered ring. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic biologically relevant scaffolds. Additionally, the spirocyclic nature may impart interesting conformational properties, influencing its biological activity. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of specific applications. Overall, tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate represents a complex and potentially versatile molecule in organic synthesis and drug development.
Formula:C13H21NO4
InChI:InChI=1/C13H21NO4/c1-12(2,3)18-11(16)14-6-4-13(5-7-14)8-10(15)9-17-13/h4-9H2,1-3H3
InChI key:XDSCHYPLQWGQRC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)CO2
Synonyms:
  • tert-Butyl-3-oxo-1-oxa-8-azaspiro[4.5]decan-8-carboxylat
Found 4 products.