CAS 955-40-8
:ethyl 1-benzyl-L-prolinate
Description:
Ethyl 1-benzyl-L-prolinate, with the CAS number 955-40-8, is an organic compound that belongs to the class of proline derivatives. It is characterized by the presence of a proline backbone, which is an amino acid, and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor due to the benzyl group attached to the proline structure. Ethyl 1-benzyl-L-prolinate is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and as a chiral building block in asymmetric synthesis. Its solubility in organic solvents, such as ethanol and dichloromethane, makes it useful in various chemical reactions. Additionally, the compound may exhibit biological activity, which is of interest in the development of new therapeutic agents. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity and reactivity.
Formula:C14H19NO2
InChI:InChI=1/C14H19NO2/c1-2-17-14(16)13-9-6-10-15(13)11-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3/t13-/m0/s1
SMILES:CCOC(=O)[C@@H]1CCCN1Cc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-Ethyl 1-benzylpyrrolidine-2-carboxylate
CAS:(S)-Ethyl 1-benzylpyrrolidine-2-carboxylateFormula:C14H19NO2Purity:≥95%Molecular weight:233.31ethyl 1-benzyl-L-prolinate
CAS:Formula:C14H19NO2Purity:95%Color and Shape:LiquidMolecular weight:233.3062ethyl benzyl-L-prolinate
CAS:Ethyl benzyl-L-prolinate is a nitrogenous organic compound that can be prepared by the oxidation of ethyl benzyl-L-proline. Crystalline ethyl benzyl-L-prolinate is an enantioselective reagent for the cyanosilylation of aldehydes with phenyllithium. It is also a stable magnesium reagent that has been used in preparative methods to produce α,β-unsaturated ketones and esters.
Formula:C14H19NO2Purity:Min. 95%Molecular weight:233.31 g/mol



