CymitQuimica logo

CAS 955138-54-2

:

(3S,4R)-4-Amino-1-Boc-3-Pyrrolidinecarboxylic Acid Ethyl Ester Hcl

Description:
(3S,4R)-4-Amino-1-Boc-3-Pyrrolidinecarboxylic Acid Ethyl Ester HCl, with the CAS number 955138-54-2, is a chiral amino acid derivative characterized by its pyrrolidine ring structure. This compound features a tert-butyloxycarbonyl (Boc) protecting group on the amino group, which is commonly used in peptide synthesis to protect amines during chemical reactions. The presence of the ethyl ester indicates that the carboxylic acid group is esterified, enhancing its solubility and reactivity. The hydrochloride salt form (HCl) improves the compound's stability and solubility in aqueous solutions, making it suitable for various biological and chemical applications. Its stereochemistry, denoted by the (3S,4R) configuration, is crucial for its biological activity, as chirality can significantly influence the interaction with biological targets. This compound is often utilized in pharmaceutical research and development, particularly in the synthesis of bioactive molecules and as a building block in medicinal chemistry.
Formula:C12H23ClN2O4
InChI:InChI=1S/C12H22N2O4.ClH/c1-5-17-10(15)8-6-14(7-9(8)13)11(16)18-12(2,3)4;/h8-9H,5-7,13H2,1-4H3;1H/t8-,9-;/m0./s1
InChI key:HBFTTYWPCPPDIT-OZZZDHQUSA-N
SMILES:CCOC(=O)[C@H]1CN(C[C@@H]1N)C(=O)OC(C)(C)C.Cl
Found 4 products.