CAS 955328-22-0
:4-amino-8-chloro-quinoline-3-carboxylic acid
Description:
4-Amino-8-chloro-quinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its polar nature, enhancing its solubility in polar solvents. The presence of a chlorine atom at the 8-position of the quinoline ring introduces additional reactivity and influences its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to other bioactive molecules. Its unique functional groups may also allow for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through experimental methods, providing insights into its behavior in different chemical environments. Overall, 4-amino-8-chloro-quinoline-3-carboxylic acid is of interest for its potential therapeutic applications and as a building block in chemical synthesis.
Formula:C10H7ClN2O2
InChI:InChI=1/C10H7ClN2O2/c11-7-3-1-2-5-8(12)6(10(14)15)4-13-9(5)7/h1-4H,(H2,12,13)(H,14,15)
SMILES:c1cc2c(c(cnc2c(c1)Cl)C(=O)O)N
Synonyms:- 3-Quinolinecarboxylic acid, 4-amino-8-chloro-
- 4-Amino-8-chloroquinoline-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Amino-8-chloroquinoline-3-carboxylic acid
CAS:Formula:C10H7ClN2O2Purity:95.0%Molecular weight:222.634-Amino-8-chloroquinoline-3-carboxylic Acid
CAS:Controlled ProductFormula:C10H7ClN2O2Color and Shape:NeatMolecular weight:222.628FTO-IN-12
CAS:FTO-IN-12 (Compound 2), an inhibitor of fat mass and obesity-related protein (FTO), exhibits Kd and IC50 values of 185 nM and 1.46 μM, respectively. This compound is utilized in researching neurodegenerative diseases.Formula:C10H7ClN2O2Color and Shape:SolidMolecular weight:222.63


