CymitQuimica logo

CAS 955376-51-9

:

6-methoxyimidazo[1,2-a]pyridine

Description:
6-Methoxyimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with a methoxy group (-OCH3) attached at the 6-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the methoxy group can influence its solubility, reactivity, and interaction with biological targets. Additionally, the imidazo and pyridine moieties contribute to its electronic properties, making it a candidate for various applications, including as a ligand in coordination chemistry or as a building block in organic synthesis. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature, and it may undergo various chemical transformations under different conditions. Overall, 6-methoxyimidazo[1,2-a]pyridine is of interest in both research and industrial contexts due to its unique structural features and potential applications.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-11-7-2-3-8-9-4-5-10(8)6-7/h2-6H,1H3
InChI key:HLTPJCOHIDPWTP-UHFFFAOYSA-N
SMILES:COc1ccc2nccn2c1
Synonyms:
  • Imidazo[1,2-a]pyridine, 6-methoxy-
  • 6-Methoxyimidazo[1,2-a]pyridine
Found 3 products.