CymitQuimica logo

CAS 95548-26-8

:

cis-vaccenoyl chloride

Description:
Cis-vaccenoyl chloride is an organic compound characterized by its acyl chloride functional group, which is derived from cis-vaccenic acid. It features a long carbon chain with a cis double bond, contributing to its unique properties. The compound is typically a colorless to pale yellow liquid with a pungent odor, indicative of the presence of the acyl chloride group. It is reactive, particularly with water, leading to hydrolysis and the formation of the corresponding acid. This reactivity makes it useful in organic synthesis, particularly in the preparation of esters and amides. Additionally, cis-vaccenoyl chloride is soluble in organic solvents, such as dichloromethane and ether, but is not soluble in water due to its hydrophobic nature. Safety precautions are necessary when handling this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Overall, cis-vaccenoyl chloride serves as an important intermediate in various chemical reactions and applications in organic chemistry.
Formula:C18H33ClO
InChI:InChI=1S/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-8H,2-6,9-17H2,1H3
InChI key:WYUXJEJFKYBBMZ-UHFFFAOYSA-N
SMILES:CCCCCCC=CCCCCCCCCCC(=O)Cl
Found 3 products.