CAS 95574-95-1
:N-Acetyl-2,7-anhydro-α-neuraminic acid
Description:
N-Acetyl-2,7-anhydro-α-neuraminic acid, commonly referred to as a derivative of sialic acid, is a naturally occurring amino sugar that plays a crucial role in cellular recognition and signaling processes. This compound is characterized by its unique structure, which includes a 2,7-anhydro configuration that contributes to its stability and biological activity. It typically exhibits a polar nature due to the presence of hydroxyl and amine functional groups, making it soluble in water and other polar solvents. The acetyl group enhances its stability and influences its interactions with proteins and other biomolecules. N-Acetyl-2,7-anhydro-α-neuraminic acid is significant in various biological processes, including cell adhesion and pathogen recognition, and is often studied for its potential applications in immunology and vaccine development. Its CAS number, 95574-95-1, is used for identification in chemical databases and regulatory contexts. Overall, this compound is an important subject of research in biochemistry and molecular biology due to its functional roles in living organisms.
Formula:C11H17NO8
InChI:InChI=1S/C11H17NO8/c1-4(14)12-7-5(15)2-11(10(17)18)19-8(6(16)3-13)9(7)20-11/h5-9,13,15-16H,2-3H2,1H3,(H,12,14)(H,17,18)/t5-,6+,7+,8+,9+,11+/m0/s1
InChI key:InChIKey=NCMJSVDTRDLWJE-YRMXFSIDSA-N
SMILES:C(O)(=O)[C@]12O[C@]([C@@H](CO)O)([C@](O1)([C@H](NC(C)=O)[C@@H](O)C2)[H])[H]
Synonyms:- N-Acetyl-2,7-anhydro-α-neuraminic acid
- 2,7-Anhydro-N-acetyl-α-neuraminic acid
- D-glycero-α-D-galacto-2-Nonulopyranosonic acid, 5-(acetylamino)-2,7-anhydro-3,5-dideoxy-
- α-Neuraminic acid, N-acetyl-2,7-anhydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Acetyl-2,7-anhydro-α-neuraminic acid
CAS:N-Acetyl-2,7-anhydro-a-neuraminic acid is a synthetic derivative of a naturally occurring sugar that is found in the human brain and other tissues. It has been proposed as a potential drug for the treatment of inflammatory bowel disease due to its ability to inhibit the growth of cells in the colon and prevent inflammation. N-Acetyl-2,7-anhydro-a-neuraminic acid has been shown to have antiinflammatory properties by inhibiting the synthesis of proinflammatory cytokines. This compound binds to an enzyme called galactosamine kinase, which is involved in making certain proteins that are necessary for inflammation. The chemical structure of N-Acetyl-2,7-anhydro-a-neuraminic acid was determined through structural analysis and carbon source titration calorimetry. Magnetic resonance spectroscopy showed that this compound reacts with water molecules and chemical ionization revealed that itFormula:C11H17NO8Purity:Min. 95%Molecular weight:291.25 g/mol
