CAS 95598-13-3

3-amino-2-benzylpropanoic acid

Description:

3-Amino-2-benzylpropanoic acid, with the CAS number 95598-13-3, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2), a carboxylic acid group (-COOH), and a benzyl side chain. This compound typically appears as a white to off-white crystalline solid. It is soluble in water and polar organic solvents, reflecting its polar functional groups. The presence of the amino and carboxylic acid groups allows it to participate in various chemical reactions, including peptide bond formation, making it relevant in biochemical applications. The benzyl group contributes to its hydrophobic character, influencing its interactions in biological systems. Additionally, 3-amino-2-benzylpropanoic acid may exhibit biological activity, potentially serving as a building block in the synthesis of peptides or pharmaceuticals. Its properties, such as melting point and stability, can vary depending on environmental conditions and the presence of other substances. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)

SMILES: c1ccc(cc1)CC(CN)C(=O)O

Synonyms:

• Benzenepropanoic acid, alpha-(aminomethyl)-
• 3-Amino-2-benzylpropanoic acid

3-Amino-2-benzylpropanoic acid

CAS: 95598-13-3

Formula: C₁₀H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.2157

Ref: IN-DA003EYW

3-Amino-2-benzylpropanoic acid

CAS: 95598-13-3

3-Amino-2-benzylpropanoic acid

Purity: ≥95%

Molecular weight: 179.219g/mol

Ref: 54-OR97858

2-Aminomethyl-3-phenylpropionic acid

CAS: 95598-13-3

Formula: C₁₀H₁₃NO₂

Purity: 97%

Molecular weight: 179.219

Ref: 10-F048197

2-Aminomethyl-3-phenylpropionic acid

CAS: 95598-13-3

2-Aminomethyl-3-phenylpropionic acid is a chemical compound that is used as a catalyst in the hydrocyanation of alkyne to produce unsaturated compounds. It is also an amino acid that contains an α-amino group and a carboxylic acid. 2-Aminomethyl-3-phenylpropionic acid has been shown to be effective for producing yields of up to 99% in nickel-based catalysts for the hydrocyanation of alkyne. This compound is also inexpensive, nonhazardous, and stable at high temperatures.

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-VDA59813