CAS 95598-13-3
:3-amino-2-benzylpropanoic acid
Description:
3-Amino-2-benzylpropanoic acid, with the CAS number 95598-13-3, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2), a carboxylic acid group (-COOH), and a benzyl side chain. This compound typically appears as a white to off-white crystalline solid. It is soluble in water and polar organic solvents, reflecting its polar functional groups. The presence of the amino and carboxylic acid groups allows it to participate in various chemical reactions, including peptide bond formation, making it relevant in biochemical applications. The benzyl group contributes to its hydrophobic character, influencing its interactions in biological systems. Additionally, 3-amino-2-benzylpropanoic acid may exhibit biological activity, potentially serving as a building block in the synthesis of peptides or pharmaceuticals. Its properties, such as melting point and stability, can vary depending on environmental conditions and the presence of other substances. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)
SMILES:c1ccc(cc1)CC(CN)C(=O)O
Synonyms:- Benzenepropanoic acid, alpha-(aminomethyl)-
- 3-Amino-2-benzylpropanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-2-benzylpropanoic acid
CAS:Formula:C10H13NO2Purity:97%Color and Shape:SolidMolecular weight:179.21573-Amino-2-benzylpropanoic acid
CAS:3-Amino-2-benzylpropanoic acidFormula:C10H13NO2Purity:≥95%Molecular weight:179.2192-Aminomethyl-3-phenylpropionic acid
CAS:2-Aminomethyl-3-phenylpropionic acid is a chemical compound that is used as a catalyst in the hydrocyanation of alkyne to produce unsaturated compounds. It is also an amino acid that contains an α-amino group and a carboxylic acid. 2-Aminomethyl-3-phenylpropionic acid has been shown to be effective for producing yields of up to 99% in nickel-based catalysts for the hydrocyanation of alkyne. This compound is also inexpensive, nonhazardous, and stable at high temperatures.Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol



