CymitQuimica logo

CAS 956-92-3

:

1H-Isoindol-1-one, 3-(4-chlorophenyl)-2,3-dihydro-3-hydroxy-

Description:
1H-Isoindol-1-one, 3-(4-chlorophenyl)-2,3-dihydro-3-hydroxy- is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system comprising a benzene ring and a five-membered nitrogen-containing ring. The presence of a hydroxyl group (-OH) at the 3-position contributes to its potential reactivity and solubility in polar solvents. The 4-chlorophenyl substituent enhances its lipophilicity and may influence its biological activity. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. The compound's CAS number, 956-92-3, serves as a unique identifier, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound suggest it may have applications in drug development and research, particularly in the fields of organic and medicinal chemistry.
Formula:C14H10ClNO2
InChI:InChI=1S/C14H10ClNO2/c15-10-7-5-9(6-8-10)14(18)12-4-2-1-3-11(12)13(17)16-14/h1-8,18H,(H,16,17)
InChI key:IVITWRDKZBYCCW-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=O)NC2(C3=CC=C(C=C3)Cl)O
Found 6 products.