CymitQuimica logo

CAS 956229-69-9

:

tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate

Description:
Tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is an organic compound characterized by its unique structure, which includes a tert-butyl ester group and a dioxaborolane moiety. This compound typically exhibits properties associated with both esters and boron-containing compounds, such as moderate solubility in organic solvents and potential reactivity in various chemical transformations. The presence of the dioxaborolane group suggests that it may participate in reactions involving boron, such as cross-coupling reactions or as a reagent in organic synthesis. Additionally, the tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and stability. The compound may also exhibit interesting properties related to its electronic structure due to the presence of the aromatic benzoate moiety. Overall, tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is likely to be of interest in synthetic organic chemistry, particularly in the development of new methodologies involving boron chemistry.
Formula:C17H25BO4
InChI:InChI=1/C17H25BO4/c1-15(2,3)20-14(19)12-10-8-9-11-13(12)18-21-16(4,5)17(6,7)22-18/h8-11H,1-7H3
InChI key:LPIQEOUMTWQOOM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)c1ccccc1B1OC(C)(C)C(C)(C)O1
Found 5 products.