CymitQuimica logo

CAS 956407-32-2

:

(6-chloropyrrolo[2,3-b]pyridin-1-yl)-triisopropyl-silane

Description:
(6-chloropyrrolo[2,3-b]pyridin-1-yl)-triisopropyl-silane is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine moiety substituted with a chlorine atom at the 6-position and a triisopropylsilyl group. This compound is likely to exhibit properties typical of organosilicon compounds, such as enhanced stability and hydrophobicity due to the presence of the triisopropylsilyl group. The chloropyrrolo structure may impart biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence the compound's reactivity and solubility, potentially affecting its interactions in biological systems. Additionally, the triisopropylsilyl group can serve as a protective or modifying group in synthetic applications. Overall, this compound's characteristics suggest it may have applications in organic synthesis, pharmaceuticals, or materials science, although specific reactivity and biological activity would require further investigation through experimental studies.
Formula:C16H25ClN2Si
InChI:InChI=1/C16H25ClN2Si/c1-11(2)20(12(3)4,13(5)6)19-10-9-14-7-8-15(17)18-16(14)19/h7-13H,1-6H3
InChI key:NBRLRDAKWUNZIN-UHFFFAOYSA-N
SMILES:CC(C)[Si](C(C)C)(C(C)C)n1ccc2ccc(Cl)nc12
Synonyms:
  • 6-Chlor-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin
  • 6-chloro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine
Found 4 products.