CymitQuimica logo

CAS 956434-30-3

:

Pyrido[3,2-f]-1,4-oxazepine-4(5H)-carboxylic acid,8-chloro-2,3-dihydro-, 1,1-dimethylethyl ester

Description:
Pyrido[3,2-f]-1,4-oxazepine-4(5H)-carboxylic acid, 8-chloro-2,3-dihydro-, 1,1-dimethylethyl ester, identified by CAS number 956434-30-3, is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine ring fused to an oxazepine moiety. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, contributing to its lipophilicity and potential biological activity. The presence of a chlorine atom at the 8-position of the bicyclic structure may influence its reactivity and interaction with biological targets. Pyrido[3,2-f]-1,4-oxazepines are of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory and analgesic effects. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H17ClN2O3
InChI:InChI=1S/C13H17ClN2O3/c1-13(2,3)19-12(17)16-6-7-18-11-9(8-16)4-5-10(14)15-11/h4-5H,6-8H2,1-3H3
InChI key:RZCINNFEMKYQKK-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCOC2=C(C1)C=CC(=N2)Cl
Found 2 products.