CymitQuimica logo

CAS 95651-19-7

:

phenyl [5-(trifluoromethyl)pyridin-2-yl]carbamate

Description:
Phenyl [5-(trifluoromethyl)pyridin-2-yl]carbamate, with the CAS number 95651-19-7, is a chemical compound characterized by its unique structure that includes a phenyl group and a pyridine ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbamate functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the pyridine ring may contribute to its ability to interact with various biological targets. The compound is likely to be soluble in organic solvents and may exhibit moderate to low solubility in water, depending on the specific conditions. Its potential applications could span across pharmaceuticals, agrochemicals, and materials science, where its unique electronic and steric properties can be exploited. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C13H9F3N2O2
InChI:InChI=1/C13H9F3N2O2/c14-13(15,16)9-6-7-11(17-8-9)18-12(19)20-10-4-2-1-3-5-10/h1-8H,(H,17,18,19)
SMILES:c1ccc(cc1)OC(=Nc1ccc(cn1)C(F)(F)F)O
Synonyms:
  • Phenyl [5-(trifluoromethyl)-2-pyridinyl]carbamate
  • Phenyl-[5-(trifluormethyl)pyridin-2-yl]carbamat
Found 2 products.