CymitQuimica logo

CAS 95656-52-3

:

4-Amino-3-chloro-5-(trifluoromethyl)benzoic acid

Description:
4-Amino-3-chloro-5-(trifluoromethyl)benzoic acid, with the CAS number 95656-52-3, is an aromatic compound characterized by the presence of an amino group, a chloro substituent, and a trifluoromethyl group on a benzoic acid framework. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure features a carboxylic acid functional group, which imparts acidic properties, while the amino group can participate in hydrogen bonding, influencing its reactivity and solubility. The trifluoromethyl group enhances the compound's lipophilicity and can significantly affect its biological activity and chemical stability. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development and as a building block in organic synthesis. Its unique combination of functional groups allows for diverse reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards.
Formula:C8H5ClF3NO2
InChI:InChI=1/C8H5ClF3NO2/c9-5-2-3(7(14)15)1-4(6(5)13)8(10,11)12/h1-2H,13H2,(H,14,15)
InChI key:LZLSLGVFHCTZAH-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1C(F)(F)F)N)Cl)C(=O)O
Synonyms:
  • Benzoic Acid, 4-Amino-3-Chloro-5-(Trifluoromethyl)-
  • 4-Amino-3-chloro-5-(trifluoromethyl)benzoic acid
Found 2 products.