CymitQuimica logo

CAS 95658-81-4

:

3-Hydroxy-5-Methylbenzonitrile

Description:
3-Hydroxy-5-Methylbenzonitrile, with the CAS number 95658-81-4, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring that also features a methyl group (-CH₃). This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the nitrile group contributes to its reactivity, making it a potential intermediate in organic synthesis. The compound may exhibit various physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Additionally, it may have applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c1-6-2-7(5-9)4-8(10)3-6/h2-4,10H,1H3
InChI key:OATUMQZBLZQKBX-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)O)C#N
Found 4 products.