CAS 956707-04-3

Formula: C15H18O4

InChI: InChI=1S/C15H18O4/c1-6-8-4-11(8)14(3)9(6)5-10-7(2)12(16)19-15(10,18)13(14)17/h8,11,13,17-18H,4-5H2,1-3H3/t8-,11-,13+,14-,15-/m1/s1

InChI key: CHTCKGZAVQQDQT-CPSKBLKCSA-N

SMILES: CC1=C2CC3=C(C(=O)O[C@]3([C@H]([C@]2([C@H]4[C@@H]1C4)C)O)O)C

8β,9α-Dihydroxylindan-4(5),7(11)-dien-8α,12-olide

CAS: 956707-04-3

8β,9α-Dihydroxylindan-4(5),7(11)-dien-8alpha,12-olide (compound 3), a sesquiterpene, exhibits anti-LIMK1 activity and inhibits cell motility [1].

Formula: C₁₅H₁₈O₄

Color and Shape: Solid

Molecular weight: 262.301

Ref: TM-T75556

8Beta,9Alpha-Dihydroxylindan-4(5),7(11)-dien-8alpha,12-olide

CAS: 956707-04-3

8Beta,9Alpha-Dihydroxylindan-4(5),7(11)-dien-8alpha,12-olide is a sesquiterpene lactone, which is a secondary metabolite predominantly isolated from plants, often in the Asteraceae family. These bioactive compounds are known for their diverse therapeutic potential, particularly in anticancer and anti-inflammatory applications. The mode of action typically involves the modulation of signaling pathways and the inhibition of transcription factors such as NF-kB, which plays a crucial role in inflammatory responses and cell survival.

Formula: C₁₅H₁₈O₄

Purity: Min. 95%

Molecular weight: 262.30 g/mol

Ref: 3D-GNB70704