CAS 956869-95-7

Formula: C14H26O4

InChI: InChI=1S/C14H26O4/c1-10(15)6-7-14(18-5)12(2,3)8-11(16)9-13(14,4)17/h6-7,10-11,15-17H,8-9H2,1-5H3/b7-6+/t10-,11-,13+,14+/m1/s1

InChI key: UIQSLOCCENWDIG-UYJPZPQLSA-N

SMILES: C[C@H](/C=C/[C@]1([C@@](C[C@@H](CC1(C)C)O)(C)O)OC)O

Euscaphin B

CAS: 956869-95-7

Euscaphin B is a naturally occurring compound, which is an organic molecule isolated from the plant Euscaphis japonica, commonly found in the family Staphyleaceae. This bioactive compound has been identified as part of the secondary metabolites produced by the plant, potentially contributing to its interaction with the environment and defense mechanisms.

Formula: C₁₄H₂₆O₄

Purity: Min. 95%

Molecular weight: 258.35 g/mol

Ref: 3D-GNB86995