CymitQuimica logo

CAS 957034-70-7

:

Boronic acid,B-[4-[(cyclopentylamino)carbonyl]-3-fluorophenyl]-

Description:
Boronic acid, specifically the compound with the name "Boronic acid, B-[4-[(cyclopentylamino)carbonyl]-3-fluorophenyl]-" and CAS number 957034-70-7, is characterized by its boron-containing functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a boronic acid moiety attached to a phenyl ring that is substituted with a cyclopentylamino carbonyl group and a fluorine atom at the para position. The presence of the cyclopentyl group contributes to its steric properties, while the fluorine atom can influence its electronic characteristics, potentially enhancing its reactivity and solubility in various solvents. Boronic acids are often utilized in organic synthesis, particularly in Suzuki coupling reactions, due to their ability to participate in cross-coupling reactions with organic halides. Additionally, the specific structural features of this compound may impart unique biological activities, making it of interest in medicinal chemistry and drug development.
Formula:C12H15BFNO3
InChI:InChI=1S/C12H15BFNO3/c14-11-7-8(13(17)18)5-6-10(11)12(16)15-9-3-1-2-4-9/h5-7,9,17-18H,1-4H2,(H,15,16)
InChI key:SWBPFXPFINCJIN-UHFFFAOYSA-N
SMILES:B(C1=CC(=C(C=C1)C(=O)NC2CCCC2)F)(O)O
Synonyms:
  • 4-(Cyclopentylcarbamoyl)-3-fluorophenylboronic acid
Found 4 products.