CymitQuimica logo

CAS 957035-08-4

:

6-Bromo-3-fluoro-2-methoxyphenylboronic acid

Description:
6-Bromo-3-fluoro-2-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with a bromine atom, a fluorine atom, and a methoxy group, which can influence its reactivity and solubility. The presence of these substituents can affect the electronic properties of the molecule, potentially enhancing its nucleophilicity or electrophilicity. Additionally, the boronic acid group contributes to its utility in medicinal chemistry and materials science, as it can participate in the formation of complex structures. This compound is typically handled with care due to the reactivity of boronic acids and the potential hazards associated with halogenated compounds. Overall, 6-Bromo-3-fluoro-2-methoxyphenylboronic acid is a valuable building block in synthetic organic chemistry.
Formula:C7H7BBrFO3
InChI:InChI=1S/C7H7BBrFO3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3,11-12H,1H3
InChI key:QBCPODUNQONQHF-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC(=C1OC)F)Br)(O)O
Synonyms:
  • 2-Borono-3-Bromo-6-Fluoroanisole
Found 3 products.