CymitQuimica logo

CAS 957035-27-7

:

4-Chloro-6-(4-iodo-1H-pyrazol-yl)pyrimidine

Description:
4-Chloro-6-(4-iodo-1H-pyrazol-yl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is substituted at the 4 and 6 positions. The presence of a chlorine atom at the 4-position and an iodo-substituted pyrazole moiety at the 6-position contributes to its unique chemical properties. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure allows for various interactions with biological targets, making it a candidate for further investigation in drug discovery. The compound is likely to exhibit moderate to high solubility in organic solvents, while its reactivity can be influenced by the halogen substituents, which can participate in nucleophilic substitution reactions. Additionally, the presence of both chlorine and iodine atoms may affect its stability and reactivity under different conditions. Overall, 4-Chloro-6-(4-iodo-1H-pyrazol-yl)pyrimidine is a significant compound in the field of organic synthesis and medicinal chemistry.
Formula:C7H4ClIN4
InChI:InChI=1S/C7H4ClIN4/c8-6-1-7(11-4-10-6)13-3-5(9)2-12-13/h1-4H
InChI key:SJJALIFOBUEFSW-UHFFFAOYSA-N
SMILES:C1=C(N=CN=C1Cl)N2C=C(C=N2)I
Synonyms:
  • 4-chloro-6-(4-iodo-1H-pyrazol-1-yl)pyrimidine
Found 2 products.