CAS 957060-90-1
:[2-(2,2,2-trifluoroethoxy)phenyl]boronic acid
Description:
[2-(2,2,2-Trifluoroethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a trifluoroethoxy group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential reactivity with various electrophiles due to the boronic acid moiety, which can participate in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The trifluoroethoxy group enhances the compound's lipophilicity and may influence its biological activity and interaction with other molecules. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug design. The presence of fluorine atoms often imparts unique electronic properties, potentially affecting the compound's reactivity and stability. Overall, [2-(2,2,2-trifluoroethoxy)phenyl]boronic acid is a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C8H8BF3O3
InChI:InChI=1/C8H8BF3O3/c10-8(11,12)5-15-7-4-2-1-3-6(7)9(13)14/h1-4,13-14H,5H2
SMILES:c1ccc(c(c1)B(O)O)OCC(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2,2,2-Trifluoroethoxy)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8BF3O3Purity:98%Molecular weight:219.952-(2,2,2-Trifluoroethoxy)benzeneboronic acid
CAS:2-(2,2,2-Trifluoroethoxy)benzeneboronic acidFormula:C8H8BF3O3Purity:98%Color and Shape:White SolidMolecular weight:219.953522-(2,2,2-Trifluoroethoxy)phenylboronic acid
CAS:Formula:C8H8BF3O3Purity:97%Color and Shape:SolidMolecular weight:219.9535



