CymitQuimica logo

CAS 957061-08-4

:

1-(1-piperidyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-ol

Description:
1-(1-Piperidyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-ol, identified by its CAS number 957061-08-4, is a chemical compound that features a complex structure incorporating a piperidine ring and a boron-containing moiety. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique functional groups. The presence of the dioxaborolane group suggests that it may participate in boron-mediated reactions, which are valuable in organic synthesis. Additionally, the phenoxy and propanol components contribute to its solubility and reactivity. The compound's molecular structure indicates it may exhibit specific biological activities, making it of interest for further research in drug discovery. Its stability, reactivity, and interaction with biological targets would be essential factors to consider in any practical applications. As with many synthetic organic compounds, safety and handling precautions are necessary due to potential toxicity or reactivity.
Formula:C20H32BNO4
InChI:InChI=1/C20H32BNO4/c1-19(2)20(3,4)26-21(25-19)16-8-10-18(11-9-16)24-15-17(23)14-22-12-6-5-7-13-22/h8-11,17,23H,5-7,12-15H2,1-4H3
InChI key:RFBSFMCUMYXPID-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)OCC(CN2CCCCC2)O)O1
Found 2 products.