CymitQuimica logo

CAS 957061-14-2

:

5-Bromo-2-fluoro-4-methylphenylboronic acid

Description:
5-Bromo-2-fluoro-4-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with a bromine atom, a fluorine atom, and a methyl group, contributing to its unique reactivity and properties. The presence of these halogen substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity in cross-coupling reactions, such as Suzuki-Miyaura coupling. Additionally, the boronic acid group allows for the formation of complexes with biomolecules, which can be advantageous in drug development and targeting specific biological pathways. The compound is typically handled with care due to its potential reactivity and the need for proper storage conditions to maintain stability. Overall, 5-Bromo-2-fluoro-4-methylphenylboronic acid is a valuable building block in synthetic chemistry and pharmaceutical research.
Formula:C7H7BBrFO2
InChI:InChI=1/C7H7BBrFO2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3,11-12H,1H3
InChI key:HTOASIJHHJJWRV-UHFFFAOYSA-N
SMILES:Cc1cc(c(cc1Br)B(O)O)F
Synonyms:
  • (5-Bromo-2-fluoro-4-methylphenyl)boronic acid
  • boronic acid, B-(5-bromo-2-fluoro-4-methylphenyl)-
Found 4 products.