CymitQuimica logo

CAS 957061-19-7

:

B-[3-Chloro-4-[(cyclopentylamino)carbonyl]phenyl]boronic acid

Description:
B-[3-Chloro-4-[(cyclopentylamino)carbonyl]phenyl]boronic acid, with the CAS number 957061-19-7, is a boronic acid derivative characterized by its boron atom bonded to a phenyl ring that features a chlorine substituent and a cyclopentylamino carbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the chlorine atom enhances its reactivity and potential for further functionalization. The cyclopentylamino group contributes to its solubility and may influence its biological activity. Additionally, boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Overall, this compound's unique structure and functional groups suggest potential utility in drug development and materials science, particularly in the design of targeted therapies or novel chemical entities.
Formula:C12H15BClNO3
InChI:InChI=1S/C12H15BClNO3/c14-11-7-8(13(17)18)5-6-10(11)12(16)15-9-3-1-2-4-9/h5-7,9,17-18H,1-4H2,(H,15,16)
InChI key:InChIKey=ZGCZUSCEHGWQRO-UHFFFAOYSA-N
SMILES:C(NC1CCCC1)(=O)C2=C(Cl)C=C(B(O)O)C=C2
Synonyms:
  • Boronic acid, B-[3-chloro-4-[(cyclopentylamino)carbonyl]phenyl]-
  • 3-Chloro-4-(cyclopentylcarbamoyl)phenylboronic acid
  • [3-Chloro-4-(cyclopentylcarbamoyl)phenyl]boronic acid
  • (3-Chloro-4-(cyclopentylcarbamoyl)phenyl)boronicacid
  • B-[3-Chloro-4-[(cyclopentylamino)carbonyl]phenyl]boronic acid
  • 3-Chloro-4-cyclopentylcarbamoylphenylboronic acid
  • 3-Chloro-4-(cyclopentylcarbamoyl)benzeneboronicacid98%
Found 4 products.