CymitQuimica logo

CAS 957062-69-0

:

B-[4-[[(3-Chlorophenyl)amino]sulfonyl]phenyl]boronic acid

Description:
B-[4-[[(3-Chlorophenyl)amino]sulfonyl]phenyl]boronic acid, identified by its CAS number 957062-69-0, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a sulfonamide moiety. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to its functional groups. The presence of the boronic acid functionality allows it to participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. Additionally, the sulfonamide group may impart biological activity, making it of interest in pharmaceutical research. The chlorophenyl substituent can influence the compound's electronic properties and reactivity. Overall, this compound is notable for its potential applications in drug development and materials science, particularly in the synthesis of complex organic molecules.
Formula:C12H11BClNO4S
InChI:InChI=1S/C12H11BClNO4S/c14-10-2-1-3-11(8-10)15-20(18,19)12-6-4-9(5-7-12)13(16)17/h1-8,15-17H
InChI key:InChIKey=RFMJCHDJLPORGS-UHFFFAOYSA-N
SMILES:S(NC1=CC(Cl)=CC=C1)(=O)(=O)C2=CC=C(B(O)O)C=C2
Synonyms:
  • (4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronicacid
  • Boronic acid, B-[4-[[(3-chlorophenyl)amino]sulfonyl]phenyl]-
  • B-[4-[[(3-Chlorophenyl)amino]sulfonyl]phenyl]boronic acid
Found 4 products.