CymitQuimica logo

CAS 957062-88-3

:

[4-(p-tolylsulfamoyl)phenyl]boronic acid

Description:
[4-(p-Tolylsulfamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a p-tolylsulfamoyl group, enhancing its solubility and reactivity. This structure contributes to its potential applications in drug development, particularly in the design of inhibitors for various biological targets. The sulfonamide moiety in the compound may also impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the boronic acid group can participate in Suzuki coupling reactions, a valuable method for forming carbon-carbon bonds in organic synthesis. Overall, [4-(p-tolylsulfamoyl)phenyl]boronic acid exhibits unique chemical properties that make it a versatile compound in both synthetic and medicinal chemistry contexts.
Formula:C13H14BNO4S
InChI:InChI=1/C13H14BNO4S/c1-10-2-6-12(7-3-10)15-20(18,19)13-8-4-11(5-9-13)14(16)17/h2-9,15-17H,1H3
InChI key:RGJGYRYMFMLJEU-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)NS(=O)(=O)c1ccc(cc1)B(O)O
Found 2 products.