CymitQuimica logo

CAS 957120-32-0

:

(5-Fluoro-2-methoxypyridin-3-yl)boronic acid

Description:
(5-Fluoro-2-methoxypyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a fluorine atom at the 5-position and a methoxy group at the 2-position of the pyridine, which influences its reactivity and solubility. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling. The presence of the fluorine atom can enhance the compound's electronic properties, potentially increasing its reactivity in certain chemical transformations. Additionally, the methoxy group can affect the compound's polarity and solubility in various solvents. Overall, (5-Fluoro-2-methoxypyridin-3-yl)boronic acid is a versatile building block in medicinal chemistry and materials science, often utilized in the development of pharmaceuticals and agrochemicals.
Formula:C6H7BFNO3
InChI:InChI=1S/C6H7BFNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3,10-11H,1H3
InChI key:ASPZNHZSIQDSTM-UHFFFAOYSA-N
SMILES:COc1c(cc(cn1)F)B(O)O
Synonyms:
  • 5-Fluoro-2-methoxypyridine-3-boronic acid
Found 4 products.