CymitQuimica logo

CAS 957120-63-7

:

5-Bromo-3-carboxy-2-fluorophenylboronic acid

Description:
5-Bromo-3-carboxy-2-fluorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. This compound features a bromine atom and a fluorine atom substituted on a phenyl ring, contributing to its unique reactivity and potential biological activity. The carboxylic acid group enhances its solubility in polar solvents and can participate in hydrogen bonding, which is beneficial for interactions in biological systems. The presence of both halogen substituents (bromine and fluorine) can influence the electronic properties of the molecule, potentially affecting its reactivity and stability. Additionally, the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Overall, 5-Bromo-3-carboxy-2-fluorophenylboronic acid is a versatile compound with significant implications in chemical research and development.
Formula:C7H5BBrFO4
InChI:InChI=1/C7H5BBrFO4/c9-3-1-4(7(11)12)6(10)5(2-3)8(13)14/h1-2,13-14H,(H,11,12)
InChI key:RFODFEHCGMALLT-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1C(=O)O)F)B(O)O)Br
Synonyms:
  • 5-Bromo-3-(dihydroxyboryl)-2-fluorobenzoic acid
  • Benzoic Acid, 3-Borono-5-Bromo-2-Fluoro-
  • 3-Borono-5-Bromo-2-Fluoro-Benzoic Acid
  • 3-Borono-5-Bromo-2-Fluorobenzoic Acid
Found 4 products.