CAS 957120-89-7

Formula: C8H7BBrNO2

InChI: InChI=1S/C8H7BBrNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11-13H

InChI key: KLQBMECATXATSZ-UHFFFAOYSA-N

SMILES: B(C1=CC2=C(N1)C(=CC=C2)Br)(O)O

7-Bromoindole-2-boronic acid

CAS: 957120-89-7

Formula: C₈H₇BBrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.8617

Ref: IN-DA005YD8

7-Bromo-1H-indole-2-boronic acid

CAS: 957120-89-7

7-Bromo-1H-indole-2-boronic acid

Formula: C₈H₇BBrNO₂

Purity: 98%

Color and Shape: Powder

Molecular weight: 239.86167

Ref: 54-OR11948

(7-Bromo-1H-indol-2-yl)boronic acid

CAS: 957120-89-7

(7-Bromo-1H-indol-2-yl)boronic acid

Formula: C₈H₇BBrNO₂

Purity: 98%

Molecular weight: 239.86

Ref: IN-DG229993

(7-Bromo-1H-indol-2-yl)boronic acid

CAS: 957120-89-7

Formula: C₈H₇BBrNO₂

Purity: 98%

Molecular weight: 239.86

Ref: 10-F211698