CymitQuimica logo

CAS 957187-28-9

:

8-bromoH-imidazo[1,2-a]pyridine

Description:
8-BromoH-imidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, with a bromine substituent at the 8-position of the imidazole ring. This compound typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions. The presence of the bromine atom enhances its reactivity and can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. It is often studied for its biological activity, particularly in medicinal chemistry, where such heterocycles can exhibit pharmacological properties. The compound's solubility and stability can vary depending on the solvent and conditions, and it may be sensitive to light and moisture. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts. Overall, 8-bromoH-imidazo[1,2-a]pyridine is of interest in both synthetic and applied chemistry fields, particularly in the development of new therapeutic agents.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-6-3-5(11(12)13)4-10-2-1-9-7(6)10/h1-4H
InChI key:RCACLYOLSQUCDP-UHFFFAOYSA-N
SMILES:C1=CN2C=C(C=C(C2=N1)Br)[N+](=O)[O-]
Found 2 products.