CymitQuimica logo

CAS 957198-30-0

:

2-(4-Morpholino)Pyrimidine-5-Boronic Acid Pinacol Ester

Description:
2-(4-Morpholino)Pyrimidine-5-Boronic Acid Pinacol Ester is a boronic acid derivative characterized by its unique structural features, which include a pyrimidine ring substituted with a morpholino group and a pinacol ester moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols and other nucleophiles, making it useful in various chemical reactions, including Suzuki coupling reactions in organic synthesis. The presence of the morpholino group enhances its solubility in polar solvents and may influence its biological activity, potentially serving as a pharmacophore in medicinal chemistry. Additionally, the pinacol ester functionality can provide stability and facilitate the handling of the boronic acid under certain conditions. Overall, this compound is of interest in both synthetic organic chemistry and pharmaceutical research due to its versatile reactivity and potential applications in drug development.
Formula:C14H22BN3O3
InChI:InChI=1S/C14H22BN3O3/c1-13(2)14(3,4)21-15(20-13)11-9-16-12(17-10-11)18-5-7-19-8-6-18/h9-10H,5-8H2,1-4H3
InChI key:HNVAYPJNFUXYII-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCOCC3
Found 5 products.