CymitQuimica logo

CAS 957204-30-7

:

2-Methyl-2-propanyl 6-hydroxy-1-indolinecarboxylate

Description:
2-Methyl-2-propanyl 6-hydroxy-1-indolinecarboxylate, identified by its CAS number 957204-30-7, is a chemical compound that belongs to the class of indoline derivatives. This substance features a complex structure characterized by an indoline ring, which is a bicyclic compound containing a fused benzene and pyrrole ring. The presence of a carboxylate group indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. The hydroxyl group at the 6-position contributes to its potential as a hydrogen bond donor, influencing its solubility and reactivity. The branched alkyl group (2-methyl-2-propanyl) enhances its steric properties, which may affect its biological activity and interaction with other molecules. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c1-13(2,3)17-12(16)14-7-6-9-4-5-10(15)8-11(9)14/h4-5,8,15H,6-7H2,1-3H3
InChI key:SXNCTPYZLPTVSQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCc2ccc(cc12)O
Synonyms:
  • 1H-Indole-1-carboxylic acid, 2,3-dihydro-6-hydroxy-, 1,1-dimethylethyl ester
Found 4 products.