CymitQuimica logo

CAS 957345-98-1

:

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxamide

Description:
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxamide is a chemical compound characterized by its unique structure, which includes a furan ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both organic and boron chemistry, making it of interest in various applications, including medicinal chemistry and materials science. The presence of the furan ring suggests potential reactivity and interactions typical of heterocyclic compounds, while the dioxaborolane group may impart specific coordination chemistry and stability. The compound is likely to be soluble in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, the presence of the amide functional group indicates potential for hydrogen bonding, which can affect its physical properties and interactions with biological systems. Overall, this compound represents a blend of structural features that may be exploited in synthetic chemistry and the development of new materials or pharmaceuticals.
Formula:C11H16BNO4
InChI:InChI=1S/C11H16BNO4/c1-10(2)11(3,4)17-12(16-10)7-5-8(9(13)14)15-6-7/h5-6H,1-4H3,(H2,13,14)
InChI key:InChIKey=KHRCOFLLLYCHES-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(N)=O)OC2
Synonyms:
  • 4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)furan-2-carboxylic acid amide
  • 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-furancarboxamide
  • 4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)furan-2-carboxamide
  • 2-Furancarboxamide, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Found 2 products.