CAS 95748-23-5

Benzeneacetonitrile, a-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-

Description:

Benzeneacetonitrile, a-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy- (CAS 95748-23-5) is a chemical compound characterized by its complex structure, which includes a benzene ring, acetonitrile functional group, and multiple methoxy groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of methoxy groups enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of the nitrile group may impart unique chemical reactivity, allowing for further derivatization or functionalization. Overall, Benzeneacetonitrile is a compound of interest in organic chemistry and medicinal chemistry, with potential applications in drug development and synthesis.

Formula: C₂₄H₃₂N₂O₄

InChI: InChI=1S/C24H32N2O4/c1-26(14-12-18-8-10-21(27-2)23(15-18)29-4)13-6-7-20(17-25)19-9-11-22(28-3)24(16-19)30-5/h8-11,15-16,20H,6-7,12-14H2,1-5H3

InChI key: FODDOFHUTVJMSE-UHFFFAOYSA-N

SMILES: CN(CCCC(C#N)C1=CC(=C(C=C1)OC)OC)CCC2=CC(=C(C=C2)OC)OC

Synonyms:

• Valeronitrile,5-[(3,4-dimethoxyphenethyl)methylamino]-2-(3,4-dimethoxyphenyl)- (7CI)

2-(3,4-Dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)-ethyl]methyl-amino}-pentanenitrile

Controlled Product

CAS: 95748-23-5

Applications 2-(3,4-Dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)-ethyl]methyl-amino}-pentanenitrile (cas# 95748-23-5) is a compound useful in organic synthesis.

Formula: C₂₄H₃₂N₂O₄

Color and Shape: Neat

Molecular weight: 412.52

Ref: TR-D460715