CymitQuimica logo

CAS 957540-36-2

:

3-(1-Pyrrolidinyl)pyrrolidine dihydrochloride

Description:
3-(1-Pyrrolidinyl)pyrrolidine dihydrochloride, with the CAS number 957540-36-2, is a chemical compound characterized by its dual pyrrolidine rings, which contribute to its structural complexity and potential biological activity. This substance is typically encountered as a dihydrochloride salt, enhancing its solubility in aqueous solutions, which is advantageous for various applications, including pharmacological research. The presence of the pyrrolidine moieties suggests that it may interact with biological systems, potentially influencing neurotransmitter pathways or exhibiting other pharmacodynamic properties. Its molecular structure may allow for specific interactions with receptors or enzymes, making it of interest in medicinal chemistry. Additionally, the dihydrochloride form indicates that it is a stable, crystalline compound under standard conditions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 3-(1-Pyrrolidinyl)pyrrolidine dihydrochloride represents a compound of interest for further investigation in both synthetic and biological chemistry contexts.
Formula:C8H18Cl2N2
InChI:InChI=1S/C8H16N2.2ClH/c1-2-6-10(5-1)8-3-4-9-7-8;;/h8-9H,1-7H2;2*1H
InChI key:BLXKBIQXWILCIT-UHFFFAOYSA-N
SMILES:C1CCN(C1)C2CCNC2.Cl.Cl
Synonyms:
  • 1-(3-Pyrrolidinyl)-pyrrolidine 2HCl
  • 1-(3-Pyrrolidinyl)-pyrrolidine Dihydrochloride
Found 3 products.