CymitQuimica logo

CAS 957674-68-9

:

Ethanone, 1-(4-ethyl-1-piperazinyl)-2-[[(5-methyl-2-phenyl-4-oxazolyl)methyl]sulfinyl]-

Description:
Ethanone, 1-(4-ethyl-1-piperazinyl)-2-[[(5-methyl-2-phenyl-4-oxazolyl)methyl]sulfinyl]- is a complex organic compound characterized by its unique structural features, which include a piperazine ring and an oxazole moiety. The presence of the piperazine group suggests potential pharmacological activity, as piperazine derivatives are often associated with various biological effects. The sulfinyl group indicates the presence of a sulfur atom bonded to an oxygen atom, which can influence the compound's reactivity and solubility. The phenyl and methyl substituents contribute to the compound's hydrophobic characteristics, potentially affecting its interaction with biological membranes. This compound may exhibit specific properties such as solubility in organic solvents, stability under certain conditions, and potential reactivity with nucleophiles or electrophiles due to the functional groups present. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C19H25N3O3S
InChI:InChI=1S/C19H25N3O3S/c1-3-21-9-11-22(12-10-21)18(23)14-26(24)13-17-15(2)25-19(20-17)16-7-5-4-6-8-16/h4-8H,3,9-14H2,1-2H3
InChI key:NKKIRUUPAMCNSI-UHFFFAOYSA-N
SMILES:CCN1CCN(CC1)C(=O)CS(=O)CC2=C(OC(=N2)C3=CC=CC=C3)C
Synonyms:
  • 1-(4-Ethylpiperazin-1-yl)-2-(((5-methyl-2-phenyloxazol-4-yl)methyl)sulfinyl)ethan-1-one
  • WAY-332082
  • Ethanone, 1-(4-ethyl-1-piperazinyl)-2-[[(5-methyl-2-phenyl-4-oxazolyl)methyl]sulfinyl]-
Found 2 products.