CymitQuimica logo

CAS 957793-95-2

:

1,1-Dimethylethyl cis-3-aminocyclobutanecarboxylate

Description:
1,1-Dimethylethyl cis-3-aminocyclobutanecarboxylate is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an amino group. The presence of the dimethyl group contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. This compound features a cis configuration, indicating that the substituents on the cyclobutane are oriented on the same side, which can affect its physical properties such as boiling and melting points. The carboxylate functional group suggests potential for forming salts or participating in various chemical reactions, including esterification and amidation. Additionally, the amino group may impart basicity and enable the compound to engage in hydrogen bonding, enhancing its solubility in polar solvents. Overall, the structural characteristics of 1,1-Dimethylethyl cis-3-aminocyclobutanecarboxylate make it a compound of interest in organic synthesis and medicinal chemistry, potentially serving as a precursor or intermediate in the development of pharmaceuticals.
Formula:C9H17NO2
InChI:InChI=1/C9H17NO2/c1-9(2,3)12-8(11)6-4-7(10)5-6/h6-7H,4-5,10H2,1-3H3/t6-,7+
InChI key:InChIKey=KNRNVMUJMBOCRF-KNVOCYPGNA-N
SMILES:C(OC(C)(C)C)(=O)[C@@H]1C[C@H](N)C1
Found 3 products.